| IUPAC Name | 3-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine |
|---|---|
| Molecular Weight | 537.65 |
| Molecular Formula | C39H27N3 |
| Canonical SMILES | C1(C2=CC=CC(C3=CN=CC=C3)=C2)=CC(C4=CC=CC(C5=CN=CC=C5)=C4)=CC(C6=CC=CC(C7=CN=CC=C7)=C6)=C1 |
| InChI | 1S/C39H27N3/c1-7-28(34-13-4-16-40-25-34)19-31(10-1)37-22-38(32-11-2-8-29(20-32)35-14-5-17-41-26-35)24-39(23-37)33-12-3-9-30(21-33)36-15-6-18-42-27-36/h1-27H,CINYXYWQPZSTOT-UHFFFAOYSA-N |
| InChI Key | CINYXYWQPZSTOT-UHFFFAOYSA-N |
| Melting Point | 195-200 °C |
| Application | Electron-transport and hole/exciton-blocking materail with high electron mobility (10-4-10-3 cm2 V-1 s-1) and high triplet energy level (2.75 eV) for highly efficient phosphorescent OLEDs application. |
| Storage | room temp |
| Assay | 98% (HPLC) |
| MDL Number | MFCD16621131 |
| Packaging | 1, 5 g in glass bottle |
| Quality Level | 100 |