| Description | 2,2',7,7'-Tetrabromo-9,9'-spirobifluorene is a spirobifluorene (SBF) derivative and is used as a blue-emitting material in electroluminescent devices. The spirobifluorene linkage in the molecule helps in decreasing the crystallization tendency and also increases the colour stability by preventing the formation of aggregates or excimers. They possess high photoluminescence efficiency and good chemical stability. |
|---|---|
| IUPAC Name | 2,2',7,7'-Tetrabromo-9,9'-spirobi[fluorene] |
| Molecular Weight | 632 |
| Molecular Formula | C25H12Br4 |
| Canonical SMILES | C1=CC2=C(C=C1Br)C3(C4=C2C=CC(=C4)Br)C5=C(C=CC(=C5)Br)C6=C3C=C(C=C6)Br |
| InChI | InChI=1S/C25H12Br4/c26-13-1-5-17-18-6-2-14(27)10-22(18)25(21(17)9-13)23-11-15(28)3-7-19(23)20-8-4-16(29)12-24(20)25/h1-12H |
| InChI Key | MASXXNUEJVMYML-UHFFFAOYSA-N |
| Boiling Point | 633.7 ºC/760mmHg (lit.) |
| Melting Point | 395-400 °C |
| Flash Point | 322.5 ºC |
| Purity | 95%+ |
| Density | 2.12 g/cm³ |
| Solubility | Insoluble in water |
| Appearance | White to off-white solid |
| Application | Blue light emitting material in Organic Light Emitting Diodes (OLEDs). |
| Storage | Sealed in dry,Room Temperature |
| Assay | 95% (HPLC) |
| MDL Number | MFCD08704220 |
| NACRES | NA.23 |
| Packaging | Packaging 1, 5 g in glass bottle |
| Quality Level | 100 |
| Refractive Index | n20/D 1.843 (lit.) |