The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| IUPAC Name | ethanolate;tantalum(5+); |
|---|---|
| Molecular Weight | 406.25 |
| Molecular Formula | Ta(OC2H5)5 |
| Canonical SMILES | CCO[Ta](OCC)(OCC)(OCC)OCC |
| InChI | 1S/5C2H5O.Ta/c5*1-2-3;/h5*2H2,1H3;/q5*-1;+5,HSXKFDGTKKAEHL-UHFFFAOYSA-N |
| InChI Key | HSXKFDGTKKAEHL-UHFFFAOYSA-N |
| Melting Point | 21 °C (lit.) |
| Application | Tantalum(V) ethoxide precursor is used to deposit ultra thin films of Tantalum oxide and other tantalum containing films by atomic layer deposition and chemical vapor deposition methods |
| Storage | 2-8°C |
| BeilsteinREAXYS Number | 3678999 |
| EC Number | 228-010-2 |
| Form | liquid |
| MDL Number | MFCD00049785 |
| Packaging | 25 g in stainless steel cylinder |
| Quality Level | 100 |
![Tris[N,N-bis(trimethylsilyl)amide]yttrium](https://resource.alfa-chemistry.com/structure/41836-28-6.gif)
