| Description | TGA/DSC Lot specific traces available upon request |
| IUPAC Name | 5,6,11,12-tetraphenyltetracene |
| Molecular Weight | 532.67 |
| Molecular Formula | C42H28 |
| Canonical SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=C(C5=CC=CC=C5C(=C24)C6=CC=CC=C6)C7=CC=CC=C7)C8=CC=CC=C8 |
| InChI | InChI=1S/C42H28/c1-5-17-29(18-6-1)37-33-25-13-14-26-34(33)39(31-21-9-3-10-22-31)42-40(32-23-11-4-12-24-32)36-28-16-15-27-35(36)38(41(37)42)30-19-7-2-8-20-30/h1-28H |
| InChI Key | YYMBJDOZVAITBP-UHFFFAOYSA-N |
| Boiling Point | 330 - 335 °C(lit.) |
| Melting Point | 330-335 °C (lit.) |
| Purity | 95%+ |
| Application | Organic electronic material useful as OLED dopant (red, λem = 550nm) and as p-type organic semiconductor. Carrier mobilities of 8-20 cm2 / Vs can be achieved in OFETs based on single crystals of sublimed rubrene. |
| Storage | room temp |
| Assay | 99.99% trace metals basis |
| BeilsteinREAXYS Number | 1917339 |
| EC Number | 208-242-0 |
| Fluorescence | λem 550 nm in THF |
| Form | ITO/CuPc/NPD/Alq3:Rubrene (5%): Dcm2 (2%)/Alq3/Mg:In• Color: red• Max. Luminance: 7780 Cd/m2 |
| Grade | sublimed grade |
| MDL Number | MFCD00003703 |
| Orbital Energy | HOMO 5.4 eV |
| Packaging | 1, 5 g in glass bottle |
| Quality Level | 100 |