Poly(methyl methacrylate-co-ethyl acrylate)
Catalog Number
ACM9010882-1
| IUPAC Name | ethyl prop-2-enoate;methyl 2-methylprop-2-enoate |
| Molecular Weight | 200.23g/mol |
| Molecular Formula | [CH2C(CH3)(CO2CH3)]X[CH2CH(CO2C2H5]Y |
| Canonical SMILES | CCOC(=O)C=C.CC(=C)C(=O)OC |
| InChI | 1S/2C5H8O2/c1-4(2)5(6)7-3;1-3-5(6)7-4-2/h1H2,2-3H3;3H,1,4H2,2H3 |
| InChI Key | XPNLOZNCOBKRNJ-UHFFFAOYSA-N |
| Application | Poly(methyl methacrylate-co-ethyl acrylate) (PMMAEA) copolymers may be used to prepare single phase mixture with phenolic derivative. PMMAEA may be used to form latex interpenetrating polymer networks (LIPNs). Membranes of PMMAEA were reportedly used for separation of heavy metal ions from aqueous solutions. |
| Storage | room temp |
| EC Number | 618-459-6 |
| Form | powder |
| Packaging | 1 kg in poly bottle |
| Quality Level | 100 |
| Transition Temperature | 580 °F |