Naphtho[1,2-b:5,6-b']dithiophene
| Description | Naphtho[1,2-b:5,6-b']dithiophene (NDT) is a π-conjugated naphthodithiophene derivative that has symmetrical planar structures. It is mainly utilized in the development of semiconductors due to its high charge mobility and high current on/off ratios. |
| IUPAC Name | [1]benzothiolo[7,6-g][1]benzothiole |
| Molecular Weight | 240.34 |
| Molecular Formula | C14H8S2 |
| Canonical SMILES | C1(C=CS2)=C2C(C=CC3=C4SC=C3)=C4C=C1 |
| InChI | 1S/C14H8S2/c1-3-11-12(13-9(1)5-7-15-13)4-2-10-6-8-16-14(10)11/h1-8H,MOZTVOICZIVCFC-UHFFFAOYSA-N |
| InChI Key | MOZTVOICZIVCFC-UHFFFAOYSA-N |
| Melting Point | 153-160 °C |
| Application | NDT has donor-acceptor copolymers which can be used in the fabrication of organic electronic devices such as organic light emitting diodes (OLEDs), organic solar cells (OSCs) and organic field effect transistors (OFETs). |
| Storage | room temp |
| Assay | 0.97 |
| MDL Number | MFCD28053549 |
| Packaging | 500 mg in glass insert |
| Quality Level | 100 |
| Semiconductor Properties | P-type (mobility>0.5 cm2 /V·s) |