N,N'-Bis(2,5-di-tert-butylphenyl)-3,4,9,10-perylenedicarboximide
Catalog Number
ACM183054802
| Description | N,N'-Bis(2,5-di-tert-butylphenyl)-3,4,9,10-perylenedicarboximide (BTBP) is a fluorescence dye that can be used as an electron acceptor. It has an extinction coefficient of 7.4 x 104 cm-1 mol-1 dm3. |
| Molecular Weight | 766.96 |
| Canonical SMILES | CC(C)(C)c1ccc(c(c1)N2C(=O)c3ccc4c5ccc6C(=O)N(C(=O)c7ccc(c8ccc(C2=O)c3c48)c5c67)c9cc(ccc9C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | 1S/C52H50N2O4/c1-49(2,3)27-13-23-37(51(7,8)9)39(25-27)53-45(55)33-19-15-29-31-17-21-35-44-36(22-18-32(42(31)44)30-16-20-34(46(53)56)43(33)41(29)30)48(58)54(47(35)57)40-26-28(50(4,5)6)14-24-38(40)52(10,11)12/h13-26H,1-12H3,BIYPCKKQAHLMHG-UHFFFAOYSA-N |
| InChI Key | BIYPCKKQAHLMHG-UHFFFAOYSA-N |
| Melting Point | >300 °C (lit.) |
| Application | BTBP is a dye that can be used in the development of organic electronic based devices which include organic light emitting diodes(OLED), electroluminescent device and organic solar cells(OSCs). |
| Storage | room temp |
| Assay | 0.97 |
| Composition | Dye content, 97% |
| MDL Number | MFCD00010562 |
| Packaging | 100 mg in glass insert |
| Quality Level | 100 |
| Semiconductor Properties | N-type (mobility=1.8x10−4 cm2 /V·s) |