| Description | Merocyanine dye, HB194 belongs to the class of absorption materials that are majorly used as donor molecules in organic electronic devices. It has a high absorption coefficient and good polarizing properties, which allow it to be utilized as a photorefractive material. |
| IUPAC Name | 2-[(2Z)-2-[(2E)-2-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)ethylidene]-3-oxoinden-1-ylidene]propanedinitrile |
| Molecular Weight | 403.5g/mol |
| Molecular Formula | C27H21N3O |
| Canonical SMILES | O=C(C1=C2C=CC=C1)/C(C2=C(C#N)C#N)=C\C=C3C(C)(C)C4=C5C(CCCN5/3)=CC=C4 |
| InChI | 1S/C27H21N3O/c1-27(2)22-11-5-7-17-8-6-14-30(25(17)22)23(27)13-12-21-24(18(15-28)16-29)19-9-3-4-10-20(19)26(21)31/h3-5,7,9-13H,6,8,14H2,1-2H3/b21-12-,23-13+ |
| InChI Key | XCFYTQCAMLKFSO-ABLMNQNHSA-N |
| Melting Point | 288-290 °C |
| Application | VAC-processed single high-efficiency Small-BHJ solar cell based on the MC dyeOPV Device Structure: ITO/MoO3/HB194: C60/BPhen/Al• JSC = 13.0 mA/cm2 • VOC = 0.96 V• FF = 0.49• PCE = 6.1% |
| Storage | room temp |
| MDL Number | MFCD28009149 |
| Packaging | 250 mg in poly bottle |
| Quality Level | 100 |