| Description | DTS(FBTTh2)2 is a conductive polymer that can be used as a donor molecule. It has a narrow band gap and shows a maximum power conversion efficiency of 7.0%. Its photostability is more than that of P3HT. |
| IUPAC Name | 4-[7,7-bis(2-ethylhexyl)-10-[5-fluoro-7-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]-3,11-dithia-7-silatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-5-fluoro-7-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-2,1,3-benzothiadiazole |
| Molecular Weight | 1219.9g/mol |
| Molecular Formula | C64H72F2N4S8Si |
| Canonical SMILES | CCCCCCc1ccc(s1)-c2ccc(s2)-c3cc(F)c(-c4cc5c(s4)-c6sc(cc6[Si]5(CC(CC)CCCC)CC(CC)CCCC)-c7c(F)cc(-c8ccc(s8)-c9ccc(CCCCCC)s9)c%10nsnc7%10)c%11nsnc3%11 |
| InChI | 1S/C64H72F2N4S8Si/c1-7-13-17-19-23-41-25-27-49(71-41)51-31-29-47(73-51)43-33-45(65)57(61-59(43)67-77-69-61)53-35-55-63(75-53)64-56(79(55,37-39(11-5)21-15-9-3)38-40(12-6)22-16-10-4)36-54(76-64)58-46(66)34-44(60-62(58)70-78-68-60)48-30-32-52(74-48)50-28-26-42(72-50)24-20-18-14-8-2/h25-36,39-40H,7-24,37-38H2,1-6H3 |
| InChI Key | LNMKMESEJYZMDZ-UHFFFAOYSA-N |
| Application | DTS(FBTTh2)2 can be used as a conjugating polymer that forms a donor-acceptor system with acceptor molecules such as perylene diimide, PC71BM and other fullerenes for the fabrication of bulk-heterojunction based solar cells. |
| Storage | room temp |
| MDL Number | MFCD23704424 |
| Packaging | 100 mg in glass insert |
| Quality Level | 100 |