| Description | A bipolar host material for highly efficient blue phosphorescent OLEDs. TAPC:DPTPCz-based device showed a high EQE of 15.4%, which is the highest performance exciplex OLED up to date. |
| IUPAC Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-phenylcarbazole |
| Molecular Weight | 474.55 |
| Molecular Formula | C33H22N4 |
| Canonical SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC4=C(C=C3)N(C5=CC=CC=C54)C6=CC=CC=C6)C7=CC=CC=C7 |
| InChI | InChI=1S/C33H22N4/c1-4-12-23(13-5-1)31-34-32(24-14-6-2-7-15-24)36-33(35-31)25-20-21-30-28(22-25)27-18-10-11-19-29(27)37(30)26-16-8-3-9-17-26/h1-22H |
| InChI Key | VPPRLINZYBFAMS-UHFFFAOYSA-N |
| Application | DPTPCz, a carbazole based bipolar host material, can be used as an acceptor molecule for the fabrication of a photosensitizer. It can also be used in application such as phosphorescent organic light-emitting diodes (OLEDs). |
| Storage | room temp |
| Assay | ≥97% |
| Form | solid |
| Quality Level | 100 |