The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| Description | Diphenyliodonium nitrate (DPIN) is a photoacid generator (PAG) that goes through photolysis reaction which can be used in the lithographic formation of UV reactive polymers. It can also be used in forming a light tuned self-assembled polyelectrolytic structures. |
|---|---|
| IUPAC Name | diphenyliodanium;nitrate |
| Molecular Weight | 343.12 |
| Molecular Formula | (C6H5)2INO3 |
| Canonical SMILES | [O-][N+]([O-])=O.[I+](c1ccccc1)c2ccccc2 |
| InChI | 1S/C12H10I.NO3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3)4/h1-10H;/q+1;-1 |
| InChI Key | CQZCVYWWRJDZBO-UHFFFAOYSA-N |
| Melting Point | 150-154 °C (lit.) |
| Application | DIPN can be used in the photo patterning of UV tuned shape memory hydrogels which can potentially be used in 3D printing. |
| Storage | room temp |
| BeilsteinREAXYS Number | 3922747 |
| EC Number | 211-962-8 |
| MDL Number | MFCD00031704 |
| Packaging | 25 g in glass bottle |
| Quality Level | 100 |
