| Description | 4,4'-Dimethoxydiphenylamine is an aromatic amine that is used as a hole transporting material that facilitates efficiency mobility of charges in an electrochemical device. |
|---|---|
| IUPAC Name | 4-Methoxy-N-(4-methoxyphenyl)aniline |
| Molecular Weight | 229.27 |
| Molecular Formula | C14H15NO2 |
| Canonical SMILES | COC1=CC=C(C=C1)NC2=CC=C(C=C2)OC |
| InChI | InChI=1S/C14H15NO2/c1-16-13-7-3-11(4-8-13)15-12-5-9-14(17-2)10-6-12/h3-10,15H,1-2H3 |
| InChI Key | VCOONNWIINSFBA-UHFFFAOYSA-N |
| Boiling Point | 371.1±27.0 °C/760mmHg (lit.) |
| Melting Point | 101-102 °C |
| Flash Point | 150.5±13.2 °C |
| Purity | 95%+ |
| Density | 1.1±0.1 g/cm³ |
| Solubility | Soluble in methanol, insoluble in water |
| Appearance | Off-white to light brown solid |
| Application | It can be used as a hole transporting material in the synthesis of 4,4'-dimethoxydiphenylamine-substituted 9,9'- bifluorenylidene with a power efficiency of ~18% which may be used in combination with an electron transporting layer in the fabrication of polymeric solar cells. It may also be used in the preparation of dimethyldiphenylamino functionalized carbazoles as electronically active materials which can potentially be used in the development of optoelectronic devices. |
| Storage | Keep in dark place,inert atmosphere,Room temperature |
| Assay | 99% |
| EC Number | 202-968-1 |
| MDL Number | MFCD00014895 |
| NACRES | NA.23 |
| Packaging | Packaging 1, 5 g in glass bottle |
| Quality Level | 100 |
| Refractive Index | n20/D 1.593 (lit.) |