| Description | D131 dye is an indoline based organic dye that has a large band-gap and can be used as a sensitizer in organic electronics. It shows a power conversion efficiency of 5.6% and can enhance photo-excitation of the electrochemical devices. |
|---|---|
| Molecular Weight | 508.61 |
| Canonical SMILES | OC(/C(C#N)=C/C(C=C1)=CC2=C1N(C3=CC=C(C=C(C4=CC=CC=C4)C5=CC=CC=C5)C=C3)C6C2CCC6)=O |
| InChI | 1S/C35H28N2O2/c36-23-28(35(38)39)20-25-16-19-34-32(22-25)30-12-7-13-33(30)37(34)29-17-14-24(15-18-29)21-31(26-8-3-1-4-9-26)27-10-5-2-6-11-27/h1-6,8-11,14-22,30,33H,7,12-13H2,(H,38,39)/b28-20+,GOTRYMLNXIJMCB-VFCFBJKWSA-N |
| InChI Key | GOTRYMLNXIJMCB-VFCFBJKWSA-N |
| Melting Point | 2-8°C |
| Application | D131 can be used in dye sensitized solar cells (DSSCs) as a photosensitizer with high charge mobility and absorption coefficient. |
| Storage | room temp |
| Assay | >95% (HPLC) |
| Form | solid |
| MDL Number | MFCD28100828 |
| Packaging | 200 mg in glass insert |
| Quality Level | 100 |