| Description | Coumarin 30 (C30) is a laser dye that has a fluorescence yield that tends to unity, which can be potentially used in optical communications and sensors. It is highly stable on the spin coating and shows high quantum efficiency upon low concentration doping. |
| IUPAC Name | 7-(diethylamino)-3-(1-methylbenzimidazol-2-yl)chromen-2-one |
| Molecular Weight | 347.4g/mol |
| Molecular Formula | C21H21N3O2 |
| Canonical SMILES | CCN(CC)c1ccc2C=C(C(=O)Oc2c1)c3nc4ccccc4n3C |
| InChI | 1S/C21H21N3O2/c1-4-24(5-2)15-11-10-14-12-16(21(25)26-19(14)13-15)20-22-17-8-6-7-9-18(17)23(20)3/h6-13H,4-5H2,1-3H3 |
| InChI Key | KZFUMWVJJNDGAU-UHFFFAOYSA-N |
| Melting Point | 225-229 °C (lit.) |
| Application | C30 can form a thin film on p-silicon (p-Si) semiconductor, which can be used to fabricate the aluminum/C30/p-Si based diodes. It can be used as a donor with fluorescein as an acceptor to study the time resolved fluorescence resonance energy transfer (FRET). |
| Storage | room temp |
| Composition | Dye content, 99% |
| EC Number | 255-186-8 |
| Fluorescence | λem 478 nm in ethanol (Lasing peak 510 nm, lasing range 492 - 550 nm (ethylene glycol), pump source Ar (458 nm)) |
| MDL Number | MFCD00051349 |
| Packaging | 100 mg in glass bottle |
| Quality Level | 200 |