| Description | Caesium carbonate or cesium carbonate is a white crystalline solid compound. Caesium carbonate has a high solubility in polar solvents such as water, alcohol and DMF. Its solubility is higher in organic solvents compared to other carbonates like potassium and sodium carbonates, although it remains quite insoluble in other organic solvents such as toluene, p-xylene, and chlorobenzene. This compound is used in organic synthesis as a base. It also appears to have applications in energy conversion. |
| IUPAC Name | Dicesium;carbonate |
| Molecular Weight | 325.82 |
| Molecular Formula | CCs2O3 |
| Canonical SMILES | C(=O)([O-])[O-].[Cs+].[Cs+] |
| InChI | InChI=1S/CH₂O3.2Cs/c2-1(3)4;/h(H2,2,3,4);/q;2*+1/p-2 |
| InChI Key | FJDQFPXHSGXQBY-UHFFFAOYSA-L |
| Melting Point | 610 °C |
| Flash Point | 169.8ºC |
| Purity | 99%+ |
| Density | 4.072 g/mL at 25 °C (lit.) |
| Solubility | Very soluble in water |
| Appearance | White powder |
| Application | Cesium carbonate (Cs2CO3) is used in the beer-brewing industry to make the "head" of beer foamier. It is also used in glassmaking and to enhance the taste of mineral water. |
| Storage | Inert atmosphere,Room Temperature |
| Assay | 99.995% trace metals basis |
| BeilsteinREAXYS Number | 4546405 |
| EC Number | 208-591-9 |
| Fluorescence | 1S/CH₂O3.2Cs/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 |
| MDL Number | MFCD00010957 |
| Packaging | 10, 50 g in poly bottle |
| Quality Level | 200 |