Camphor-10-sulfonic acid (β)
Catalog Number
ACM5872082-1
| Description | Camphorsulfonic acid is a organosulphur compound. |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
| Molecular Weight | 232.3 |
| Molecular Formula | C10H16O4S |
| Canonical SMILES | [H][C@@]12CC[C@@](CS(O)(=O)=O)(C(=O)C1)C2(C)C |
| InChI | 1S/C10H16O4S/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h7H,3-6H2,1-2H3,(H,12,13,14)/t7-,10-/m1/s1 |
| InChI Key | MIOPJNTWMNEORI-GMSGAONNSA-N |
| Melting Point | 203-206 °C (dec.) (lit.) |
| Application | Camphor-10-sulfonic acid (β) (CSA) is extensively used as an acid catalyst.• It can be used in a catalytic amount to protect hydroxyl groups as tetrahydropyranyl (THP) ethers using dihydropyran.• It also catalyzes the protection of ketones as ketals.• It is a useful catalyst for the intramolecular ring opening of epoxides.• CSA can also be used to catalyze nucleophile-promoted alkyne-iminium cyclization in the total synthesis of pumiliotoxin A. |
| Storage | room temp |
| Assay | 0.98 |
| BeilsteinREAXYS Number | 3205973 |
| EC Number | 227-527-0 |
| MDL Number | MFCD00074827 |
| Packaging | 100, 500 g in glass bottle |
| Quality Level | 200 |