Benzo[c][1,2,5]thiadiazol-5-ylboronic acid pinacol ester
Catalog Number
ACM1168135032-1
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole |
| Molecular Weight | 262.14 |
| Molecular Formula | C12H15BN2O2S |
| Canonical SMILES | CC1(C)OB(OC1(C)C)c2ccc3nsnc3c2 |
| InChI | 1S/C12H15BN2O2S/c1-11(2)12(3,4)17-13(16-11)8-5-6-9-10(7-8)15-18-14-9/h5-7H,1-4H3,KISHNZJGTMYYKH-UHFFFAOYSA-N |
| InChI Key | KISHNZJGTMYYKH-UHFFFAOYSA-N |
| Melting Point | 81-86 °C,2-8°C |
| Application | Benzo[c][1,2,5]thiadiazol-5-ylboronic acid pinacol ester can be used as a reactant: • To synthesize 5-methylbenzo[c][1,2,5]thiadiazole by methylation reaction with methyl iodide using palladium catalyst.• In the Miyaura borylation and Suzuki coupling reactions.• To prepare benzothiadiazole derivatives as potent PFKFB3 kinase inhibitors. |
| Storage | room temp |
| Assay | 0.97 |
| MDL Number | MFCD11867874 |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |