Description | It's an aryl boronate ester. Arylboronic acids may be prepared by hydrolysis of boronate esters, and consequently many other boronic acid derivatives (e.g., organotrifluoroborates) are derived. |
---|---|
IUPAC Name | 2-[7-(1,3,2-dioxaborinan-2-yl)-9,9-dioctylfluoren-2-yl]-1,3,2-dioxaborinane |
Molecular Weight | 558.41 |
Molecular Formula | C3H6O2BC6H3C(C8H17)2C6H3BO2C3H6 |
Canonical SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(ccc2-c3ccc(cc13)B4OCCCO4)B5OCCCO5 |
InChI | 1S/C35H52B2O4/c1-3-5-7-9-11-13-21-35(22-14-12-10-8-6-4-2)33-27-29(36-38-23-15-24-39-36)17-19-31(33)32-20-18-30(28-34(32)35)37-40-25-16-26-41-37/h17-20,27-28H,3-16,21-26H2,1-2H3 |
InChI Key | KAYXDWIILRESPY-UHFFFAOYSA-N |
Melting Point | 126-130 °C (lit.) |
Purity | ≥ 97% |
Application | This product is suitable for scientific research. |
Storage | room temp |
Assay | 97% |
MDL Number | MFCD03701607 |
NACRES | NA.23 |
Packaging | Packaging 1, 5 g in glass bottle |
Quality Level | 100 |