The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| Description | 8-Hydroxyquinoline Zinc is generally immediately available in most volumes. |
|---|---|
| IUPAC Name | zinc;quinolin-8-olate |
| Molecular Weight | 353.69 |
| Molecular Formula | C18H12N2O2Zn·xH2O |
| Canonical SMILES | C[Zn](C)(Oc1cccc2cccnc12)Oc3cccc4cccnc34 |
| InChI | InChI=1S/2C9H7NO.Zn/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;/h2*1-6,11H;/q;;+2/p-2 |
| InChI Key | HTPBWAPZAJWXKY-UHFFFAOYSA-L |
| Melting Point | 166 °C |
| Purity | >93.0%(T) |
| Appearance | Yellow to Brown to Dark green powder to crystal |
| Application | Bis(8-quinolinolato-N1,O8)-zinc(II) complex (Znq2) can be employed as an electron transfer layer in organic light-emitting diodes. |
| Storage | Sealed in dry. Room temperature. |
| Assay | 0.99 |
| EC Number | 237-762-0 |
| Fluorescence | λex 325 nm; λem 484 nm in chloroform |
| Form | ITO/TPD/Znq/Mg:In[3]• Color: yellow• Max. Luminance: 16200 Cd/m2 |
| MDL Number | MFCD00065291 |
| Packaging | 5 g in glass bottle |
| Quality Level | 100 |
![Tris[2-(4,6-difluorophenyl)pyridinato-C2,N]iridium(III)](https://resource.alfa-chemistry.com/structure/387859-70-3.gif)
iridium(III)](https://resource.alfa-chemistry.com/structure/337526-85-9.gif)
iridium(III)](https://resource.alfa-chemistry.com/structure/337526-86-0.gif)
