| IUPAC Name | 6-bromo-3-(6-bromo-2-hydroxy-1H-indol-3-yl)indol-2-one |
|---|---|
| Molecular Weight | 420.06 |
| Molecular Formula | C16H8Br2N2O2 |
| Canonical SMILES | O=C1NC2=C(C=CC(Br)=C2)/C1=C3C(NC4=C\3C=CC(Br)=C4)=O |
| InChI | InChI=1S/C16H8Br2N2O2/c17-7-1-3-9-11(5-7)19-15(21)13(9)14-10-4-2-8(18)6-12(10)20-16(14)22/h1-6,19,21H |
| InChI Key | FMIGDKYPJSFPDF-UHFFFAOYSA-N |
| Melting Point | >300 °C |
| Purity | >96.0%(HPLC)(N) |
| Appearance | Orange to Brown to Dark red powder to crystal |
| Application | Electron accepting building block for the preparation of electroactive materials for organic electronics. |
| Storage | room temp |
| Assay | 0.98 |
| Form | powder |
| MDL Number | MFCD29917500 |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |