| IUPAC Name | 5H-pyrido[3,2-b]indole |
| Molecular Weight | 168.2 |
| Molecular Formula | C11H8N2 |
| Canonical SMILES | C1(C=CC=C2)=C2C(N=CC=C3)=C3N1 |
| InChI | InChI=1S/C11H8N2/c1-2-5-9-8(4-1)11-10(13-9)6-3-7-12-11/h1-7,13H |
| InChI Key | NSBVOLBUJPCPFH-UHFFFAOYSA-N |
| Boiling Point | 372.9ºC at 760mmHg |
| Melting Point | 213 °C |
| Flash Point | 171.6ºC |
| Purity | >98.0%(HPLC) |
| Density | 1.301g/cm3 |
| Appearance | White to Yellow to Green powder to crystal |
| Application | Novel aromatic amine compound for organic electroluminescent device, illuminating device and display. |
| Storage | room temp |
| Assay | 99% (HPLC) |
| Form | powder |
| MDL Number | MFCD13178683 |
| Packaging | 250 mg in glass bottle |
| Quality Level | 100 |