| IUPAC Name | 4,7-dibromo-5-fluoro-2,1,3-benzothiadiazole |
|---|---|
| Molecular Weight | 311.96 |
| Molecular Formula | C6HBr2FN2S |
| Canonical SMILES | BrC1=C(F)C=C(Br)C2=NSN=C21 |
| InChI | 1S/C6HBr2FN2S/c7-2-1-3(9)4(8)6-5(2)10-12-11-6/h1H |
| InChI Key | KVZDYOVYIHJETJ-UHFFFAOYSA-N |
| Melting Point | 158-163 °C |
| Purity | >98.0%(GC) |
| Density | Light Sensitive,Air Sensitive |
| Appearance | White to Orange to Green powder to crystal |
| Application | Monomer for synthesis of polymers for high power conversion efficiency (PCE) organic solar cells and high mobility OFETs. Fluorination lowers the polymer HOMO level; resulting in high open-circuit voltages well exceeding 0.7 V. High-Efficiency Polymer F-PCPDTBT:PC70BM Bulk Heterojuction Organic Solar Cells (OPVs): JSC = 14.1 mA/cm2 VOC = 0.74 V FF = 0.58 PCE = 6.2% |
| Storage | Store under inert gas |
| Assay | 99% (HPLC) |
| MDL Number | MFCD26939241 |
| NACRES | NA.23 |
| Packaging | Packaging 1 g in glass bottle |
| Quality Level | 100 |