2-[(7-{4-[N,N-Bis(4-methylphenyl)amino]phenyl}-2,1,3-benzothiadiazol-4-yl)methylene]propanedinitrile
Catalog Number
ACM1393343582-1
| Description | 2-((7-{4-[N,N-Bis(4-methylphenyl)amino]phenyl}-2,1,3-benzothiadiazol-4-yl)methylene)propanedinitrile (DTDCPB) is a donor-acceptor molecule which can be used in the fabrication of organic electronic devices such as organic solar cells (OSCs) and organic photovoltaics (OPVs). |
| IUPAC Name | 2-[[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-7-yl]methylidene]propanedinitrile |
| Molecular Weight | 483.59 |
| Molecular Formula | C30H21N5S |
| Canonical SMILES | Cc1ccc(cc1)N(c2ccc(C)cc2)c3ccc(cc3)-c4ccc(\C=C(/C#N)C#N)c5nsnc45 |
| InChI | 1S/C30H21N5S/c1-20-3-10-25(11-4-20)35(26-12-5-21(2)6-13-26)27-14-7-23(8-15-27)28-16-9-24(17-22(18-31)19-32)29-30(28)34-36-33-29/h3-17H,1-2H3,METIWNNPHPBEHP-UHFFFAOYSA-N |
| InChI Key | METIWNNPHPBEHP-UHFFFAOYSA-N |
| Melting Point | 285-290 °C |
| Application | 7.9% efficient vapor-deposited organic photovoltaic cells base on a simple bulk heterojunctionA vacuum-deposited organic solar cell employing this novel donor-acceptor-acceptor (D-A-A) donor molecule; DTDCPB; combined with the electron acceptor C60/ C70 achieved a record-high power conversion efficiency (PCE) of 6.8%.Device structure:MoO3 (30nm) / DTDCPB (7nm) / DTDCPB:C70 (40nm) / C70 (7nm) / BCP (10nm) / Ag (150nm)Device performance:• JSC = 13.48 mA/cm2 • VOC = 0.95 V• FF = 0.55• PCE = 6.8% |
| Storage | room temp |
| Assay | 97% (HPLC) |
| MDL Number | MFCD24849728 |
| Packaging | 500 mg in glass insert |
| Quality Level | 100 |