| Description | 1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione is a thienopyrrolodione (TPD) based electron acceptor material (n-type semiconductor) which is used widely for organic photovoltaic (OPV) applications. They have very powerful electron withdrawing capability. TPD based conjugated polymers have exhibited a Power Conversion Efficiency (PCE) of as high as 7.3% in bulk heterojunction polymer solar cells. |
|---|---|
| IUPAC Name | 1,3-dibromo-5-octylthieno[3,4-c]pyrrole-4,6-dione |
| Molecular Weight | 423.16 |
| Molecular Formula | C14H17Br2NO2S |
| Canonical SMILES | CCCCCCCCN1C(=O)c2c(Br)sc(Br)c2C1=O |
| InChI | 1S/C14H17Br2NO2S/c1-2-3-4-5-6-7-8-17-13(18)9-10(14(17)19)12(16)20-11(9)15/h2-8H2,1H3 |
| InChI Key | GSGMEQUXTCYOAU-UHFFFAOYSA-N |
| Melting Point | 105-109 °C |
| Purity | ≥ 97% |
| Application | Used as an electron acceptor material (n-type semiconductor) in Polymer Solar Cells. |
| Storage | room temp |
| Assay | ≥99.5% (HPLC) |
| MDL Number | MFCD18804055 |
| NACRES | NA.23 |
| Packaging | Packaging 1 g in glass bottle |
| Quality Level | 100 |