The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| IUPAC Name | 1,3,6,8-tetrabromopyrene |
|---|---|
| Molecular Weight | 517.80 |
| Molecular Formula | C16H6Br4 |
| Canonical SMILES | Brc1cc(Br)c2ccc3c(Br)cc(Br)c4ccc1c2c34 |
| InChI | 1S/C16H6Br4/c17-11-5-13(19)9-3-4-10-14(20)6-12(18)8-2-1-7(11)15(9)16(8)10/h1-6H |
| InChI Key | ZKBKRTZIYOKNRG-UHFFFAOYSA-N |
| Boiling Point | 416-420 °C |
| Melting Point | 416-420 °C |
| Flash Point | 273.9 ºC |
| Purity | 95% |
| Density | 2.284g/cm3 |
| Appearance | Pale yellow powder |
| Application | Synthetic building block for the creation of blue to green OLED emitters |
| Storage | room temp |
| Assay | 0.97 |
| EC Number | 204-900-6 |
| MDL Number | MFCD00428682 |
| Packaging | 5 g in glass bottle |
| Quality Level | 100 |
![2,8-Dibromo-6,12-dihydro-6,6,12,12-tetraoctyl-indeno[1,2-b]fluorene](https://resource.alfa-chemistry.com/structure/264281-45-0.gif)
