The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| Description | 1,3,6,8(2H,7H)-Tetraone, 2,7-dicyclohexylbenzo[lmn][3,8]phenanthroline (NDI-cy6) is a naphthalene-diimide based polymeric semiconducting material. It forms an n-type conductive layer that facilitates the conjugating system with electron mobility of 12 cm2 V-1s-1. |
|---|---|
| Molecular Weight | 430.5 |
| Canonical SMILES | O=C1N(C2CCCCC2)C(=O)c3ccc4C(=O)N(C5CCCCC5)C(=O)c6ccc1c3c46 |
| InChI | 1S/C26H26N2O4/c29-23-17-11-13-19-22-20(26(32)28(25(19)31)16-9-5-2-6-10-16)14-12-18(21(17)22)24(30)27(23)15-7-3-1-4-8-15/h11-16H,1-10H2,XWDVNWORIROXKG-UHFFFAOYSA-N |
| InChI Key | XWDVNWORIROXKG-UHFFFAOYSA-N |
| Melting Point | 360-365 °C |
| Application | NDI-cy6 can be used as an electron transporting layer for the development of organic electronic devices which include organic field effect transistors (OFETs) and thin film transistors (TFTs). |
| Storage | room temp |
| Assay | 0.98 |
| MDL Number | MFCD00333604 |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |
| Semiconductor Properties | N-type (mobility=6 cm2 /V·s) |