The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| Molecular Weight | 638.71 |
|---|---|
| Molecular Formula | Y(OCC(CH3)3CHCOC(CH3)3)3 |
| Canonical SMILES | CC(C)(C)C(=O)\C=C(/O[Y](O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | 1S/3C11H20O2.Y/c3*1-10(2,3)8(12)7-9(13)11(4,5)6;/h3*7,12H,1-6H3;/q;;;+3/p-3/b3*8-7-;,PPRRRPCEDUWEHL-LWTKGLMZSA-K |
| InChI Key | PPRRRPCEDUWEHL-LWTKGLMZSA-K |
| Boiling Point | 290°C |
| Melting Point | 173-175 °C |
| Application | A precursor for the formation of thin films of yttria by CECVD. The films have potential applications as electronic insulators, coatings, reaction barriers and superconducting materials. |
| Storage | Room temperature, dry |
| Assay | 99.9% trace metals basis |
| Form | solid |
| MDL Number | MFCD00015713 |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |
