Yttrium(III) tris(2,2,6,6-tetramethyl-3,5-heptanedionate)
Molecular Weight | 638.71 |
Molecular Formula | Y(OCC(CH3)3CHCOC(CH3)3)3 |
Canonical SMILES | CC(C)(C)C(=O)\C=C(/O[Y](O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C |
InChI | 1S/3C11H20O2.Y/c3*1-10(2,3)8(12)7-9(13)11(4,5)6;/h3*7,12H,1-6H3;/q;;;+3/p-3/b3*8-7-;,PPRRRPCEDUWEHL-LWTKGLMZSA-K |
InChI Key | PPRRRPCEDUWEHL-LWTKGLMZSA-K |
Boiling Point | 290°C |
Melting Point | 173-175 °C |
Application | A precursor for the formation of thin films of yttria by CECVD. The films have potential applications as electronic insulators, coatings, reaction barriers and superconducting materials. |
Storage | Room temperature, dry |
Assay | 99.9% trace metals basis |
Form | solid |
MDL Number | MFCD00015713 |
Packaging | 1 g in glass bottle |
Quality Level | 100 |