The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| Description | N-Hydroxynaphthalimide triflate (HNT) is a photoacid generator(PAG) that forms an acid upon exposure to UV light which can be used to generate patterned structures. It can also be used to tune the solubility of a polymer by forming acid linkages. |
|---|---|
| Canonical SMILES | FC(F)(F)S(=O)(=O)ON1C(=O)c2cccc3cccc(C1=O)c23 |
| InChI | 1S/C13H6F3NO5S/c14-13(15,16)23(20,21)22-17-11(18)8-5-1-3-7-4-2-6-9(10(7)8)12(17)19/h1-6H |
| InChI Key | LWHOMMCIJIJIGV-UHFFFAOYSA-N |
| Melting Point | 212.1-214.2 °C |
| Application | HNT can be used to form patterned nanoparticles that find potential applications in volumetric manufacturing of semiconductor devices. It can also be used in the photo-responsive pore reopening of zeolites that facilitates the regulation of the gas permeation process. UV-irradiated trimethylsilyl ultrathin cellulose based films can be formed in presence of HNT as a PAG. |
| Storage | room temp |
| Assay | ≥99% |
| Grade | electronic grade |
| MDL Number | MFCD02683478 |
| Packaging | 1 g in amber poly bottle |
| Quality Level | 100 |