N-Hydroxynaphthalimide triflate
Synonyms
N-Hydroxynaphthalimide trifluoromethanesulfonate,HNT,NHN-TF
Description | N-Hydroxynaphthalimide triflate (HNT) is a photoacid generator(PAG) that forms an acid upon exposure to UV light which can be used to generate patterned structures. It can also be used to tune the solubility of a polymer by forming acid linkages. |
Canonical SMILES | FC(F)(F)S(=O)(=O)ON1C(=O)c2cccc3cccc(C1=O)c23 |
InChI | 1S/C13H6F3NO5S/c14-13(15,16)23(20,21)22-17-11(18)8-5-1-3-7-4-2-6-9(10(7)8)12(17)19/h1-6H |
InChI Key | LWHOMMCIJIJIGV-UHFFFAOYSA-N |
Melting Point | 212.1-214.2 °C |
Application | HNT can be used to form patterned nanoparticles that find potential applications in volumetric manufacturing of semiconductor devices. It can also be used in the photo-responsive pore reopening of zeolites that facilitates the regulation of the gas permeation process. UV-irradiated trimethylsilyl ultrathin cellulose based films can be formed in presence of HNT as a PAG. |
Storage | room temp |
Assay | ≥99% |
Grade | electronic grade |
MDL Number | MFCD02683478 |
Packaging | 1 g in amber poly bottle |
Quality Level | 100 |