Hafnium isopropoxide isopropanol adduct
Catalog Number
ACM2171995-1
| Molecular Weight | 414.84 |
| Canonical SMILES | CC(C)O[Hf](OC(C)C)(OC(C)C)OC(C)C |
| InChI | 1S/4C3H7O.Hf/c4*1-3(2)4;/h4*3H,1-2H3;/q4*-1;+4,HRDRRWUDXWRQTB-UHFFFAOYSA-N |
| InChI Key | HRDRRWUDXWRQTB-UHFFFAOYSA-N |
| Solubility | core: hafnium |
| Application | Hafnium isopropoxide isopropanol adduct was used as a precursor to prepare mesoporous HfO2 by the thermohydrolytic approach. The high active surface area and uniform porosity enables these HfO2 to be used as adsorbents for sequestration of heavy metal ions. |
| Storage | room temp |
| Assay | 99.9% trace metals basis |
| Form | crystalline powder |
| Impurity Content | ~1% Zr |
| MDL Number | MFCD00070460 |
| Packaging | 5 g in glass bottle |
| Quality Level | 100 |