| IUPAC Name | 9-[3-[6-(3-carbazol-9-ylphenyl)pyridin-2-yl]phenyl]carbazole |
| Molecular Weight | 561.67 |
| Molecular Formula | C41H27N3 |
| Canonical SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=CC(=C4)C5=NC(=CC=C5)C6=CC(=CC=C6)N7C8=CC=CC=C8C9=CC=CC=C97 |
| InChI | InChI=1S/C41H27N3/c1-5-22-38-32(16-1)33-17-2-6-23-39(33)43(38)30-14-9-12-28(26-30)36-20-11-21-37(42-36)29-13-10-15-31(27-29)44-40-24-7-3-18-34(40)35-19-4-8-25-41(35)44/h1-27H |
| InChI Key | UFWDOFZYKRDHPB-UHFFFAOYSA-N |
| Boiling Point | 228.0 - 232.0 °C |
| Purity | 95%+ |
| Density | 1.21 g/ml |
| Application | 26DCzPPy serves as a key component in organic light-emitting diodes (OLEDs) by acting as a bipolar host material. Its design includes combining carbazole electron donors with high triplet energy and pyridine electron acceptors with high electron affinity. This unique configuration enhances the performance and efficiency of OLEDs. By facilitating both electron and hole transport, 26DCzPPy contributes to improved color rendering index (CRI) and overall device efficiency. Its high triplet energy, carrier mobilities, and deep highest occupied molecular orbital (HOMO) level make it a popular choice in the development of advanced OLED technologies. |
| Storage | room temp |
| MDL Number | MFCD20275106 |
| Quality Level | 100 |