The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| Description | Such benzimidazole derivatives are usually associated with various kinds of pharmacokinetic and pharmacodynamic properties. Their heterocyclic structure possess wide range of antimicrobial properties. |
|---|---|
| IUPAC Name | 2-(4-methylpyridin-2-yl)-1H-benzimidazole |
| Molecular Weight | 209.25 |
| Molecular Formula | C13H11N3 |
| Canonical SMILES | Cc1ccnc(c1)-c2nc3ccccc3[nH]2 |
| InChI | 1S/C13H11N3/c1-9-6-7-14-12(8-9)13-15-10-4-2-3-5-11(10)16-13/h2-8H,1H3,(H,15,16) |
| InChI Key | MGBRKEZZOSQHQO-UHFFFAOYSA-N |
| Melting Point | 225-230 °C |
| Application | This product is suitable for scientific research. |
| Storage | room temp |
| Assay | 99% (GC) |
| MDL Number | MFCD03659221 |
| NACRES | NA.23 |
| Packaging | Packaging 1 g in glass bottle |
| Quality Level | 100 |
![Dichlorotetrakis[3,5-difluoro-2-(2-pyridinyl)phenyl]diiridium(III)](https://resource.alfa-chemistry.com/structure/dichlorotetrakis%5B3%2C5-difluoro-2-%282-pyridinyl%29phenyl%5Ddiiridium%28iii%29.gif)
