| Description | 2,2'-Bithiophene is an electron transporting material with the π-electrons present in the system that facilitate charge mobility. |
|---|---|
| IUPAC Name | 2-Thiophen-2-ylthiophene |
| Molecular Weight | 166.3 |
| Molecular Formula | C8H6S2 |
| Canonical SMILES | C1=CSC(=C1)C2=CC=CS2 |
| InChI | InChI=1S/C8H6S2/c1-3-7(9-5-1)8-4-2-6-10-8/h1-6H |
| InChI Key | OHZAHWOAMVVGEL-UHFFFAOYSA-N |
| Boiling Point | 260 °C/760mmHg (lit.) |
| Melting Point | 32-33 °C |
| Flash Point | 76.3±6.6 °C |
| Purity | 95%+ |
| Density | 1.2±0.1 g/cm³ |
| Solubility | Insoluble in water |
| Appearance | Solid |
| Application | 2,2'-Bithiophene can be polymerized to form poly(2,2'-Bithiophene) which can be electrodeposited on indium tin oxide (ITO) substrates for the fabrication of electrochromic devices. It can also be used in the formation of electrode material for the development of supercapacitors. Substrate used in a rhodium-catalyzed C-H arylation of heteroarenes with aryl iodides. |
| Storage | Keep in dark place,inert atmosphere,Room Temperature |
| Assay | 99% |
| BeilsteinREAXYS Number | 3039 |
| EC Number | 207-767-2 |
| MDL Number | MFCD00005414 |
| NACRES | NA.23 |
| Packaging | Packaging 10 g in glass bottle |
| Quality Level | 100 |
| Refractive Index | n20/D 1.631 (lit.) |