The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| IUPAC Name | chromium(2+); cyclopenta-1,3-diene |
|---|---|
| Molecular Weight | 182.18 |
| Molecular Formula | Cr(C5H5)2 |
| Canonical SMILES | [Cr].[CH]1[CH][CH][CH][CH]1.[CH]2[CH][CH][CH][CH]2 |
| InChI | 1S/2C5H5.Cr/c2*1-2-4-5-3-1;/h2*1-5H;,OXPNGPODCRFNTM-UHFFFAOYSA-N |
| InChI Key | OXPNGPODCRFNTM-UHFFFAOYSA-N |
| Boiling Point | 41.5ºC at 760 mmHg |
| Melting Point | 168-170 °C (lit.) |
| Purity | 96% |
| Appearance | bordeaux crystalline powder |
| Application | Catalyst for:• Stereoselective pinacol-type cross-coupling reactions• Thermal homo-polymerization and co-polymerization reactions• Nozaki-Hiyama-Kishi reactions (additions of organic halides to aldehydes) |
| Storage | room temp |
| Assay | 0.95 |
| EC Number | 215-036-4 |
| Form | solid |
| MDL Number | MFCD00013750 |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |