The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| IUPAC Name | Triphenylene |
|---|---|
| Molecular Weight | 228.3 |
| Molecular Formula | C18H12 |
| Canonical SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C4=CC=CC=C24 |
| InChI | InChI=1S/C18H12/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18/h1-12H |
| InChI Key | SLGBZMMZGDRARJ-UHFFFAOYSA-N |
| Boiling Point | 438 ºC |
| Melting Point | 195-198 ºC |
| Purity | 99%+ |
| Density | 1.302 g/ml |
| Solubility | 1.80e-07 M |
| Appearance | White to beige crystalline |
| Storage | room temp |
| Assay | 0.98 |
| BeilsteinREAXYS Number | 1342908 |
| EC Number | 205-922-9 |
| Fluorescence | λex 265 nm; λem 372 nm in cyclohexane |
| MDL Number | MFCD00001108 |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |
| Vapor Pressure | 2.10e-08 mmHg |
![4-[2-[5-[4-(Diethylamino)phenyl]-4,5-dihydro-1-phenyl-1H-pyrazol-3-yl]ethenyl]-N,N-diethylaniline](https://resource.alfa-chemistry.com/structure/57609-72-0.gif)