| Description | Triphenylborane is generally immediately available in most volumes. |
| IUPAC Name | triphenylborane |
| Molecular Weight | 242.13 |
| Molecular Formula | (C6H5)3B |
| Canonical SMILES | c1ccc(cc1)B(c2ccccc2)c3ccccc3 |
| InChI | InChI=1S/C18H15B/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChI Key | MXSVLWZRHLXFKH-UHFFFAOYSA-N |
| Boiling Point | 203-208℃ |
| Melting Point | 145-147℃ |
| Flash Point | -17 °C(1.4 °F) |
| Purity | 99% | 99.9% | 99.99% | 99.999% |
| Density | 0.898 g/mL at 25 °C |
| Appearance | Crystalline powder |
| Application | Triphenylborane powder is a boron based precursor that can be used in the chemical vapor deposition for the development of carbon nanomaterials for application in oxygen reduction reaction, hydrogen storage, transparent conducting films, and fluoride shuffle batteries. |
| Storage | room temp |
| BeilsteinREAXYS Number | 1961313 |
| EC Number | 213-504-2 |
| Form | powder |
| Impurity Content | <2% H₂O |
| MDL Number | MFCD00003007 |
| Packaging | 2.5, 10 g in glass bottle |
| Quality Level | 100 |