The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| Description | Atomic number of base material: 22 Titanium |
|---|---|
| Molecular Weight | 280.28 |
| Molecular Formula | [(CH3C2H5)N]4Ti |
| Canonical SMILES | CCN(C)[Ti](N(C)CC)(N(C)CC)N(C)CC |
| InChI | 1S/4C3H8N.Ti/c4*1-3-4-2;/h4*3H2,1-2H3;/q4*-1;+4,LNKYFCABELSPAN-UHFFFAOYSA-N |
| InChI Key | LNKYFCABELSPAN-UHFFFAOYSA-N |
| Boiling Point | 80 °C/0.1 mmHg (lit.) |
| Density | 0.923 g/mL at 25 °C (lit.) |
| Solubility | core: titanium |
| Application | Precursor to titanium nitride (TiN) thin films by organometallic chemical vapor deposition (OMCVD). |
| Storage | 2-8°C |
| Assay | ≥99.99% |
| Form | liquid |
| Grade | electronic grade |
| MDL Number | MFCD00799591 |
| Packaging | 5 g in ampule |
| Quality Level | 100 |
