| Description | Poly(3-butylthiophene-2,5-diyl) (P3BT) is an alkylthiophene based conducting polymer that can be used as a donor molecule in the development of organic electronics. It is a π-conjugating polymer with a π-π stacking distance of 0.395 nm. Conducting polymer, 80-90% head-to-tail regiospecific conformation. |
|---|---|
| IUPAC Name | 3-butyl-2,5-dimethylthiophene |
| Molecular Weight | Mw 54,000 (typical) |
| Molecular Formula | C10H16S |
| Canonical SMILES | CCCCC1=C(SC(=C1)C)C |
| InChI | InChI=1S/C10H16S/c1-4-5-6-10-7-8(2)11-9(10)3/h7H,4-6H2,1-3H3 |
| InChI Key | DUOSBQJOYVIVOR-UHFFFAOYSA-N |
| Solubility | chlorinated solvents: soluble (partially soluble in THF, diethylether) |
| Appearance | black |
| Application | P3BT can act as a hole transporting layer (HTL) which can potentially be used in the fabrication of organic field effect transistors (OFETs), chemical sensors, rechargeable batteries and polymeric solar cells (PSCs). Rechargeable battery electrodes, electrochromic devices, chemical and optical sensors, light-emitting diodes, microelectrical amplifiers, field-effect transistors and non-linear optical materials. |
| Storage | room temp |
| Fluorescence | λex 419 nm; λem 550 nm in chloroform |
| MDL Number | MFCD00677712 |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |