N,N'-Dioctyl-3,4,9,10-perylenedicarboximide
Catalog Number
ACM78151583-2
| IUPAC Name | 7,18-dioctyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| Molecular Weight | 614.77 |
| Molecular Formula | C40H42N2O4 |
| Canonical SMILES | CCCCCCCCN1C(=O)c2ccc3c4ccc5C(=O)N(CCCCCCCC)C(=O)c6ccc(c7ccc(C1=O)c2c37)c4c56 |
| InChI | 1S/C40H42N2O4/c1-3-5-7-9-11-13-23-41-37(43)29-19-15-25-27-17-21-31-36-32(40(46)42(39(31)45)24-14-12-10-8-6-4-2)22-18-28(34(27)36)26-16-20-30(38(41)44)35(29)33(25)26/h15-22H,3-14,23-24H2,1-2H3,YFGMQDNQVFJKTR-UHFFFAOYSA-N |
| InChI Key | YFGMQDNQVFJKTR-UHFFFAOYSA-N |
| Melting Point | >300 °C |
| Application | PTCDI-C8 can be used as an organic semiconductor to fabricate a wide range of opto-electronic based devices such as light emitting diodes, photovoltaic cells, and field effect transistors. |
| Storage | room temp |
| Assay | 0.98 |
| Fluorescence | λem ≤533 nm in chloroform |
| MDL Number | MFCD08276854 |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |
| Semiconductor Properties | N-type (mobility=1.7 cm2 /V·s) |