The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| Description | Colourless liquid, sweet fruity balsamic odour |
|---|---|
| IUPAC Name | 2-Methylpropyl (E)-3-phenylprop-2-enoate |
| Molecular Weight | 204.26 |
| Molecular Formula | C13H16O2 |
| Canonical SMILES | CC(C)COC(=O)C=CC1=CC=CC=C1 |
| InChI | InChI=1S/C13H16O2/c1-11(2)10-15-13(14)9-8-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3/b9-8+ |
| InChI Key | IQZUZPKOFSOVET-CMDGGOBGSA-N |
| Boiling Point | 287 °C |
| Flash Point | 237 °F |
| Purity | 98%+ |
| Density | 1 g/mL at 25 °C(lit.) |
| Solubility | Insoluble in water; soluble in oils |
| Appearance | Colorless to pale yellow clear liquid (est) |
| Application | This product is suitable for scientific research. |
| Storage | room temp |
| Assay | 0.99 |
| EC Number | 204-564-0 |
| Fluorescence | 1S/C13H16O2/c1-11(2)10-15-13(14)9-8-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3/b9-8+ |
| MDL Number | MFCD00038289 |
| NACRES | NA.23 |
| Packaging | 1 kg |
| Quality Level | 100 |
| Refractive Index | n20/D 1.54(lit.) |
