The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| Description | Isobornyl methacrylate is a reactive solvent with low vapor pressure. It facilitates the free radical polymerization by forming a polymer with high glass transition temperature (Tg). |
|---|---|
| IUPAC Name | [(1R,4R,6R)-1,7,7-trimethyl-6-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
| Molecular Weight | 222.32 |
| Molecular Formula | C14H22O2 |
| Canonical SMILES | CC(=C)C(=O)OC1C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | 1S/C14H22O2/c1-9(2)12(15)16-11-8-10-6-7-14(11,5)13(10,3)4/h10-11H,1,6-8H2,2-5H3/t10-,11?,14+/m1/s1 |
| InChI Key | IAXXETNIOYFMLW-JENJKZFGSA-N |
| Boiling Point | 127-129 °C/15 mmHg (lit.) |
| Melting Point | -60°C |
| Flash Point | 101°C |
| Purity | >85.0%(GC) |
| Density | 0.98 |
| Appearance | Clear, yellow liquid |
| Application | This product is suitable for scientific research. |
| Storage | room temp |
| Assay | 0.98 |
| EC Number | 231-403-1 |
| Fluorescence | 1S/C14H22O2/c1-9(2)12(15)16-11-8-10-6-7-14(11,5)13(10,3)4/h10-11H,1,6-8H2,2-5H3/t10-,11?,14+/m1/s1 |
| Grade | technical grade |
| MDL Number | MFCD00081070 |
| NACRES | NA.23 |
| Packaging | 1 kg |
| Quality Level | 200 |
| Refractive Index | 1.476-1.478 |
| Viscosity | 8.1cp (25°C) |