| Description | Liquid |
|---|---|
| IUPAC Name | [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate |
| Molecular Weight | 208.30 |
| Molecular Formula | C13H20O2 |
| Canonical SMILES | [H][C@]12CC[C@@](C)([C@@H](C1)OC(=O)C=C)C2(C)C |
| InChI | 1S/C13H20O2/c1-5-11(14)15-10-8-9-6-7-13(10,4)12(9,2)3/h5,9-10H,1,6-8H2,2-4H3/t9-,10-,13+/m0/s1 |
| InChI Key | PSGCQDPCAWOCSH-OUJBWJOFSA-N |
| Boiling Point | 119-121 °C/15 mmHg (lit.) |
| Melting Point | 97.0 °C |
| Flash Point | 104 °C(219.2 °F) |
| Purity | >90.0%(GC) |
| Density | 0.986 g/mL at 25 °C (lit.) |
| Appearance | Colorless to Almost colorless clear liquid |
| Application | Isobornyl acrylate (IBA) can be used to prepare block copolymers with n-butyl acrylate by atom transfer radical polymerization (ATRP). |
| Storage | room temp |
| EC Number | 227-561-6 |
| Fluorescence | 1S/C13H20O2/c1-5-11(14)15-10-8-9-6-7-13(10,4)12(9,2)3/h5,9-10H,1,6-8H2,2-4H3/t9-,10-,13+/m0/s1 |
| Grade | technical grade |
| MDL Number | MFCD00080424 |
| NACRES | NA.23 |
| Packaging | Packaging 1 L in poly bottle 100, 500 mL in poly bottle |
| Quality Level | 100 |
| Refractive Index | n20/D 1.476 (lit.) |
| Viscosity | 9cp (25°C) |