The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
![{[CurrentData.Name]}](https://resource.alfachemic.com/structure/118129-60-5.gif)
| IUPAC Name | 11,22-dibromo-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone |
|---|---|
| Molecular Weight | 550.11 |
| Molecular Formula | C24H6Br2O6 |
| Canonical SMILES | O=C(C(C=C1)=C2C3=C1C4=C5C(C3=C(Br)C=C26)=CC=C7C5=C(C(OC7=O)=O)C=C4Br)OC6=O |
| InChI | 1S/C24H6Br2O6/c25-13-5-12-16-10(22(28)32-24(12)30)4-2-8-18-14(26)6-11-15-9(21(27)31-23(11)29)3-1-7(19(15)18)17(13)20(8)16/h1-6H,WPBVUAVIGWNDGT-UHFFFAOYSA-N |
| InChI Key | WPBVUAVIGWNDGT-UHFFFAOYSA-N |
| Application | Synthetic building block of high-mobility air-stable n-type semiconductors (electron-transport small organic molecules and polymers). |
| Storage | room temp |
| Assay | 0.98 |
| Form | powder |
| MDL Number | MFCD11870875 |
| Packaging | 1 g in poly bottle |
| Quality Level | 100 |