IUPAC Name | 2,5-dibromo-3,4-dinitrothiophene |
---|---|
Molecular Weight | 331.93 |
Molecular Formula | C4Br2N2O4S |
Canonical SMILES | [O-][N+](=O)c1c(Br)sc(Br)c1[N+]([O-])=O |
InChI | 1S/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
InChI Key | AHGHPBPARMANQD-UHFFFAOYSA-N |
Melting Point | 135-140 °C |
Purity | 98% |
Application | This monomer is useful in the Pd catalyzed Stille coupling to make conjugated thiophene oligomers or co-oligomers. The corresponding amine(s) can be obtained by subsequent reduction. |
Storage | room temp |
Assay | 99% (GC) |
MDL Number | MFCD00015537 |
NACRES | NA.23 |
Packaging | Packaging 1, 5 g in glass bottle |
Quality Level | 100 |