| IUPAC Name | 2,5-dibromo-3,4-dinitrothiophene |
|---|---|
| Molecular Weight | 331.93 |
| Molecular Formula | C4Br2N2O4S |
| Canonical SMILES | [O-][N+](=O)c1c(Br)sc(Br)c1[N+]([O-])=O |
| InChI | 1S/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
| InChI Key | AHGHPBPARMANQD-UHFFFAOYSA-N |
| Melting Point | 135-140 °C |
| Purity | 98% |
| Application | This monomer is useful in the Pd catalyzed Stille coupling to make conjugated thiophene oligomers or co-oligomers. The corresponding amine(s) can be obtained by subsequent reduction. |
| Storage | room temp |
| Assay | 99% (GC) |
| MDL Number | MFCD00015537 |
| NACRES | NA.23 |
| Packaging | Packaging 1, 5 g in glass bottle |
| Quality Level | 100 |