The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
![{[CurrentData.Name]}](https://resource.alfachemic.com/structure/77-92-9.gif)
| Description | Inherently natural as it occurs in citric fruits, produced by fermentation of carbohydrates |
|---|---|
| IUPAC Name | 2-Hydroxypropane-1,2,3-tricarboxylic acid |
| Molecular Weight | 192.12 |
| Molecular Formula | C6H8O7 |
| Canonical SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChI Key | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| Boiling Point | 248.08 °C |
| Melting Point | 153-159 °C(lit.) |
| Flash Point | 100 °C |
| Purity | 99%+ |
| Density | 1.67 g/cm³ at 20 °C |
| Solubility | Very soluble in water, slightly soluble in ether |
| Appearance | Solid |
| Application | Creams, lotions, shampoos, shower gels, bath bombs/fizzes (combined with sodium bicarbonate). |
| Storage | 2-8 °C |
| Composition | Citric acid |
| Form | Neat |
| NACRES | NA.24 |
| Packaging | Unit quantity: 50 mg. Subject to change. The product is delivered as supplied by the issuing Pharmacopoeia. |
| pH | 3.24 (1 mM solution) |
| Quality Level | 200 |
| Refractive Index | 1.493-1.509 |