The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| IUPAC Name | bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
|---|---|
| Molecular Weight | 182.17g/mol |
| Molecular Formula | C9H10O4 |
| Canonical SMILES | OC(=O)[C@@H]1[C@H]2C[C@H](C=C2)[C@@H]1C(O)=O |
| InChI | 1S/C9H10O4/c10-8(11)6-4-1-2-5(3-4)7(6)9(12)13/h1-2,4-7H,3H2,(H,10,11)(H,12,13)/t4-,5+,6-,7+ |
| InChI Key | NIDNOXCRFUCAKQ-UMRXKNAASA-N |
| Melting Point | 175 °C (dec.) (lit.) |
| Storage | room temp |
| Assay | 98% |
| EC Number | 223-301-0 |
| Fluorescence | 1S/C9H10O4/c10-8(11)6-4-1-2-5(3-4)7(6)9(12)13/h1-2,4-7H,3H2,(H,10,11)(H,12,13)/t4-,5+,6-,7+ |
| MDL Number | MFCD00003735 |
| Packaging | 5, 25 g in glass bottle |
| Quality Level | 100 |
![3-Oxabicyclo[3.1.0]hexane-2,4-dione](https://resource.alfa-chemistry.com/structure/5617-74-3.gif)
![1,1,3,3-Tetramethyl-1,3-Bis[2-(5-Norbornen-2-yl)Ethyl]Disiloxane, Mixture of Endo and Exo](https://resource.alfa-chemistry.com/structure/198570-39-7.gif)
