The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
![{[CurrentData.Name]}](https://resource.alfachemic.com/structure/118448-18-3.gif)
| Molecular Weight | 406.61 |
|---|---|
| Molecular Formula | Ca(OCC(CH3)3CHCOC(CH3)3)2 |
| Canonical SMILES | CC(C)(C)C(=O)\C=C(/O[Ca]O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | 1S/2C11H20O2.Ca/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;/h2*7,12H,1-6H3;/q;;+2/p-2/b2*8-7-;,DOOFPPIHJGRIGW-ATMONBRVSA-L |
| InChI Key | DOOFPPIHJGRIGW-ATMONBRVSA-L |
| Melting Point | 221-224 °C (lit.) |
| Solubility | core: calcium |
| Application | Used in the preparation of thin-film superconductors. |
| Storage | room temp |
| Composition | Ca, 8.7-11.0% EDTA titration |
| Form | solid |
| MDL Number | MFCD00064757 |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |