The Best Industrial
Solution Provider
Certified Company
ISO 9001:2015 Certification
Solution Provider
ISO 9001:2015 Certification
| Description | Atomic number of base material: 27 Cobalt |
|---|---|
| Molecular Weight | 245.23 |
| Molecular Formula | C14H18Co |
| Canonical SMILES | CC[C]1[CH][CH][CH][CH]1.CC[C]1[CH][CH][CH][CH]1.[Co] |
| InChI | InChI=1S/2C7H9.Co/c2*1-2-7-5-3-4-6-7;/h2*3-6H,2H2,1H3; |
| InChI Key | YHCQFTZSIGZRTR-UHFFFAOYSA-N |
| Flash Point | >230 °F |
| Purity | 95%+ |
| Density | 1.516 g/mL at 25 °C (lit.) |
| Appearance | Liquid |
| Application | This metallocene compound may be encapsulated in single walled carbon nanotubes, resulting in a tailored carbon nano structure of specific electronic functionality. |
| Storage | room temp |
| Form | liquid |
| MDL Number | MFCD01863655 |
| Packaging | 1 g in glass bottle |
| Quality Level | 100 |
