| Description | 9H-Carbazole-9-(4-phenyl) boronic acid pinacol ester is a compound that is majorly used as an intermediate in electronic devices. Its molecular structure includes benzene rings, boronic acid pinacol ester and carbazole rings. |
|---|---|
| IUPAC Name | 9-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole |
| Molecular Weight | 369.26 |
| Molecular Formula | C24H24BNO2 |
| Canonical SMILES | CC1(C)OB(OC1(C)C)c2ccc(cc2)-n3c4ccccc4c5ccccc35 |
| InChI | 1S/C24H24BNO2/c1-23(2)24(3,4)28-25(27-23)17-13-15-18(16-14-17)26-21-11-7-5-9-19(21)20-10-6-8-12-22(20)26/h5-16H,1-4H3 |
| InChI Key | AHDSYMVAUJZCOP-UHFFFAOYSA-N |
| Melting Point | 165-173 °C |
| Application | 9H-Carbazole-9-(4-phenyl) boronic acid pinacol can be used as a donor molecule in the formation of novel donor-π-acceptor dyes for electrochemical s. It can also be used in the formation of organic light emitting diodes (OLEDs). |
| Storage | room temp |
| Assay | 95% |
| MDL Number | MFCD16294549 |
| NACRES | NA.23 |
| Packaging | Packaging 1, 5 g in glass bottle |
| Quality Level | 100 |