| IUPAC Name | 9-heptadecan-9-yl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazole |
|---|---|
| Molecular Weight | 657.58 |
| Molecular Formula | C41H65B2NO4 |
| Canonical SMILES | CCCCCCCCC(CCCCCCCC)n1c2cc(ccc2c3ccc(cc13)B4OC(C)(C)C(C)(C)O4)B5OC(C)(C)C(C)(C)O5 |
| InChI | 1S/C41H65B2NO4/c1-11-13-15-17-19-21-23-33(24-22-20-18-16-14-12-2)44-36-29-31(42-45-38(3,4)39(5,6)46-42)25-27-34(36)35-28-26-32(30-37(35)44)43-47-40(7,8)41(9,10)48-43/h25-30,33H,11-24H2,1-10H3 |
| InChI Key | XMKFCPVHTTWWCK-UHFFFAOYSA-N |
| Purity | ≥ 97% |
| Application | This material is used in the formation of low band gap semiconducting materials for low cost plastic solar cells 9-(9-Heptadecanyl)-9H-carbazole-2,7-diboronic acid bis(pinacol) ester can be used in the synthesis of organic semiconducting polymers for optoelectronic s such as organic photovoltaics. |
| Storage | room temp |
| Assay | 97% |
| Form | powder |
| MDL Number | MFCD16621134 |
| NACRES | NA.23 |
| Packaging | Packaging 500 mg in glass insert |
| Quality Level | 100 |