| IUPAC Name | 2-(9,9-dimethylfluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| Molecular Weight | 320.23 |
| Molecular Formula | C21H25BO2 |
| Canonical SMILES | CC1(C)OB(OC1(C)C)c2ccc3-c4ccccc4C(C)(C)c3c2 |
| InChI | 1S/C21H25BO2/c1-19(2)17-10-8-7-9-15(17)16-12-11-14(13-18(16)19)22-23-20(3,4)21(5,6)24-22/h7-13H,1-6H3 |
| InChI Key | DAZFRJAIIUPRQZ-UHFFFAOYSA-N |
| Melting Point | 130-135 °C |
| Purity | ≥ 97% |
| Application | 9,9-Dimethylfluorene-2-boronic acid pinacol ester can be used in the synthesis of 1,2-diphenylindolizine derivatives for potential usage in organic light emitting diodes (OLEDs). It can also be used in the synthesis of pyrene-fluorene based chromophores for s in photocatalysis and organic electronic devices. |
| Storage | room temp |
| Assay | 95% |
| MDL Number | MFCD08704229 |
| NACRES | NA.23 |
| Packaging | Packaging 1 g in glass bottle |
| Quality Level | 100 |